AX40922
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
1mg | 98% | in stock | $42.00 | $30.00 | - + | |
5mg | 98% | in stock | $105.00 | $73.00 | - + | |
10mg | 98% | in stock | $202.00 | $141.00 | - + | |
25mg | 98% | in stock | $489.00 | $342.00 | - + | |
50mg | 98% | in stock | $667.00 | $467.00 | - + | |
100mg | 98% | in stock | $1,049.00 | $734.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AX40922 |
Chemical Name: | BAY 41-4109 Racemate |
CAS Number: | 298708-79-9 |
Molecular Formula: | C18H13ClF3N3O2 |
Molecular Weight: | 395.7629 |
MDL Number: | MFCD30729326 |
SMILES: | COC(=O)C1=C(C)N=C(NC1c1ccc(cc1Cl)F)c1ncc(cc1F)F |
Complexity: | 645 |
Covalently-Bonded Unit Count: | 1 |
Heavy Atom Count: | 27 |
Hydrogen Bond Acceptor Count: | 7 |
Hydrogen Bond Donor Count: | 1 |
Rotatable Bond Count: | 4 |
Undefined Atom Stereocenter Count: | 1 |
XLogP3: | 3.1 |
Antimicrobial agents and chemotherapy 20131101