AB72587
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
1mg | 98% | in stock | $19.00 | $13.00 | - + | |
5mg | 98% | in stock | $44.00 | $31.00 | - + | |
25mg | 98% | in stock | $105.00 | $74.00 | - + | |
100mg | 98% | in stock | $361.00 | $253.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AB72587 |
Chemical Name: | Dibenzoyl thiamine |
CAS Number: | 299-88-7 |
Molecular Formula: | C26H26N4O4S |
Molecular Weight: | 490.574 |
MDL Number: | MFCD00867787 |
SMILES: | O=CN(/C(=C(SC(=O)c1ccccc1)/CCOC(=O)c1ccccc1)/C)Cc1cnc(nc1N)C |
Complexity: | 750 |
Covalently-Bonded Unit Count: | 1 |
Defined Bond Stereocenter Count: | 1 |
Heavy Atom Count: | 35 |
Hydrogen Bond Acceptor Count: | 8 |
Hydrogen Bond Donor Count: | 1 |
Rotatable Bond Count: | 11 |
XLogP3: | 3.8 |
Dibenzoyl thiamine is a versatile compound commonly used in chemical synthesis. This molecule plays a crucial role in various organic reactions as a catalyst, especially in the formation of carbon-carbon bonds. Its unique structure and reactivity make it a valuable tool for both academic research and industrial applications. When utilized in chemical synthesis, Dibenzoyl thiamine facilitates the efficient and selective production of complex organic molecules, making it a fundamental component in modern synthetic chemistry.