AB46990
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
1mg | 95% | in stock | $58.00 | $41.00 | - + | |
5mg | 95% | in stock | $137.00 | $96.00 | - + | |
10mg | 95% | in stock | $255.00 | $179.00 | - + | |
50mg | 95% | in stock | $320.00 | $224.00 | - + | |
100mg | 95% | in stock | $463.00 | $324.00 | - + | |
250mg | 95% | in stock | $889.00 | $622.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AB46990 |
Chemical Name: | 6-Methyl-1'-[2-(5-methyl-2-phenyl-4-oxazolyl)ethyl]spiro[4H-3,1-benzoxazine-4,4'-piperidin]-2(1H)-one |
CAS Number: | 300816-15-3 |
Molecular Formula: | C25H27N3O3 |
Molecular Weight: | 417.5002 |
MDL Number: | MFCD09038564 |
SMILES: | O=C1Nc2ccc(cc2C2(O1)CCN(CC2)CCc1nc(oc1C)c1ccccc1)C |
Complexity: | 630 |
Covalently-Bonded Unit Count: | 1 |
Heavy Atom Count: | 31 |
Hydrogen Bond Acceptor Count: | 5 |
Hydrogen Bond Donor Count: | 1 |
Rotatable Bond Count: | 4 |
XLogP3: | 4.3 |
Journal of the American Society of Nephrology : JASN 20031001
Journal of medicinal chemistry 20030911