AB75421
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
1g | 97% | in stock | $16.00 | $11.00 | - + | |
5g | 97% | in stock | $17.00 | $12.00 | - + | |
10g | 97% | in stock | $21.00 | $15.00 | - + | |
500g | 97% | in stock | $941.00 | $659.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AB75421 |
Chemical Name: | Methyl 2-(2-nitrophenyl)acetate |
CAS Number: | 30095-98-8 |
Molecular Formula: | C9H9NO4 |
Molecular Weight: | 195.17206000000002 |
MDL Number: | MFCD00968465 |
SMILES: | COC(=O)Cc1ccccc1[N+](=O)[O-] |
Complexity: | 223 |
Covalently-Bonded Unit Count: | 1 |
Heavy Atom Count: | 14 |
Hydrogen Bond Acceptor Count: | 4 |
Rotatable Bond Count: | 3 |
XLogP3: | 1.9 |
The Journal of organic chemistry 20010420