AB39878
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
1g | 98% | in stock | $8.00 | $6.00 | - + | |
5g | 95%(HPLC) | in stock | $28.00 | $20.00 | - + | |
25g | 95%(HPLC) | in stock | $59.00 | $41.00 | - + | |
100g | 95%(HPLC) | in stock | $176.00 | $123.00 | - + | |
250g | 95%(HPLC) | in stock | $351.00 | $246.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AB39878 |
Chemical Name: | Bis[3,4,6-trichloro-2-(pentyloxycarbonyl)phenyl] oxalate |
CAS Number: | 30431-54-0 |
Molecular Formula: | C26H24Cl6O8 |
Molecular Weight: | 677.1820 |
MDL Number: | MFCD00191674 |
SMILES: | CCCCCOC(=O)c1c(OC(=O)C(=O)Oc2c(Cl)cc(c(c2C(=O)OCCCCC)Cl)Cl)c(Cl)cc(c1Cl)Cl |
Complexity: | 795 |
Covalently-Bonded Unit Count: | 1 |
Heavy Atom Count: | 40 |
Hydrogen Bond Acceptor Count: | 8 |
Rotatable Bond Count: | 17 |
XLogP3: | 10.6 |
Talanta 20081019
The Analyst 20080601
The journal of physical chemistry. A 20071004
Talanta 20070615
Analytical and bioanalytical chemistry 20070301