AB40228
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
1mg | 98% | in stock | $19.00 | $13.00 | - + | |
5mg | 98% | in stock | $25.00 | $18.00 | - + | |
10mg | 98% | in stock | $39.00 | $27.00 | - + | |
25mg | 98% | in stock | $60.00 | $42.00 | - + | |
50mg | 98% | in stock | $99.00 | $69.00 | - + | |
100mg | 98% | in stock | $163.00 | $114.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AB40228 |
Chemical Name: | 1-Piperazinamine, N-[(3,5-dimethyl-1-phenyl-1H-pyrazol-4-yl)methylene]-4-(phenylmethyl)- |
CAS Number: | 304909-07-7 |
Molecular Formula: | C23H27N5 |
Molecular Weight: | 373.494 |
MDL Number: | MFCD01827306 |
SMILES: | Cc1nn(c(c1C=NN1CCN(CC1)Cc1ccccc1)C)c1ccccc1 |
NSC Number: | 731871 |
Complexity: | 489 |
Covalently-Bonded Unit Count: | 1 |
Defined Bond Stereocenter Count: | 1 |
Heavy Atom Count: | 28 |
Hydrogen Bond Acceptor Count: | 4 |
Rotatable Bond Count: | 5 |
XLogP3: | 4.2 |
Bioorganic & medicinal chemistry letters 20100815
Bioorganic & medicinal chemistry letters 20100101
The Journal of biological chemistry 20020419