AB49743
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
1g | 98% | in stock | $8.00 | $5.00 | - + | |
5g | 98% | in stock | $12.00 | $8.00 | - + | |
25g | 98% | in stock | $45.00 | $31.00 | - + | |
100g | 98% | in stock | $172.00 | $120.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AB49743 |
Chemical Name: | L-Aspartic acid 4-tert-butyl ester |
CAS Number: | 3057-74-7 |
Molecular Formula: | C8H15NO4 |
Molecular Weight: | 189.209 |
MDL Number: | MFCD06809742 |
SMILES: | N[C@H](C(=O)O)CC(=O)OC(C)(C)C |
Complexity: | 207 |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 1 |
Heavy Atom Count: | 13 |
Hydrogen Bond Acceptor Count: | 5 |
Hydrogen Bond Donor Count: | 2 |
Rotatable Bond Count: | 5 |
XLogP3: | -1.4 |
The Journal of organic chemistry 20020208