AF28582
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
1g | 98% | in stock | $103.00 | $72.00 | - + | |
5g | 98% | in stock | $369.00 | $258.00 | - + | |
10g | 98% | in stock | $651.00 | $456.00 | - + | |
25g | 98% | in stock | $1,319.00 | $923.00 | - + | |
100g | 98% | in stock | $3,278.00 | $2,295.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AF28582 |
Chemical Name: | H-Ala-phe-oh |
CAS Number: | 3061-90-3 |
Molecular Formula: | C12H16N2O3 |
Molecular Weight: | 236.2670 |
MDL Number: | MFCD00066031 |
SMILES: | CC(C(=O)NC(C(=O)O)Cc1ccccc1)N |
Complexity: | 275 |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 2 |
Heavy Atom Count: | 17 |
Hydrogen Bond Acceptor Count: | 4 |
Hydrogen Bond Donor Count: | 3 |
Rotatable Bond Count: | 5 |
XLogP3: | -2.5 |
Sheng wu gong cheng xue bao = Chinese journal of biotechnology 20170125
Protein science : a publication of the Protein Society 20120501
The journal of physical chemistry. B 20120216
Protein expression and purification 20101001
Chemical biology & drug design 20100101
Journal of the American Chemical Society 20080409
Chemphyschem : a European journal of chemical physics and physical chemistry 20080314
Journal of agricultural and food chemistry 20071017
Analytical biochemistry 20070815
The journal of physical chemistry. B 20060706
Journal of medicinal chemistry 20060615
Electrophoresis 20050201
Current medicinal chemistry 20050101
Journal of medicinal chemistry 20000224