AB40913
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
250mg | 98% | in stock | $30.00 | $21.00 | - + | |
1g | 98% | in stock | $73.00 | $51.00 | - + | |
5g | 98% | in stock | $249.00 | $175.00 | - + | |
10g | 98% | in stock | $401.00 | $281.00 | - + | |
25g | 98% | in stock | $712.00 | $498.00 | - + | |
100g | 98% | in stock | $1,955.00 | $1,369.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AB40913 |
Chemical Name: | 1-Isopropyl-1,2,3-benzotriazole-5-carboxylic acid |
CAS Number: | 306935-41-1 |
Molecular Formula: | C10H11N3O2 |
Molecular Weight: | 205.2132 |
MDL Number: | MFCD01570664 |
SMILES: | OC(=O)c1ccc2c(c1)nnn2C(C)C |
Complexity: | 257 |
Covalently-Bonded Unit Count: | 1 |
Heavy Atom Count: | 15 |
Hydrogen Bond Acceptor Count: | 4 |
Hydrogen Bond Donor Count: | 1 |
Rotatable Bond Count: | 2 |
XLogP3: | 1.5 |
Journal of medicinal chemistry 20120412
Journal of medicinal chemistry 20081225
Journal of medicinal chemistry 20060223