AB42158
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
250mg | 95% | in stock | $8.00 | $5.00 | - + | |
1g | 95% | in stock | $10.00 | $7.00 | - + | |
5g | 95% | in stock | $31.00 | $22.00 | - + | |
10g | 95% | in stock | $62.00 | $44.00 | - + | |
25g | 95% | in stock | $136.00 | $95.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AB42158 |
Chemical Name: | (2R,5S)-tert-Butyl 2,5-dimethylpiperazine-1-carboxylate |
CAS Number: | 309915-46-6 |
Molecular Formula: | C11H22N2O2 |
Molecular Weight: | 214.3046 |
MDL Number: | MFCD06797728 |
SMILES: | C[C@@H]1NC[C@H](N(C1)C(=O)OC(C)(C)C)C |
Complexity: | 235 |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 2 |
Heavy Atom Count: | 15 |
Hydrogen Bond Acceptor Count: | 3 |
Hydrogen Bond Donor Count: | 1 |
Rotatable Bond Count: | 2 |
XLogP3: | 1.3 |
(2R,5S)-tert-Butyl 2,5-dimethylpiperazine-1-carboxylate is a versatile compound widely used in chemical synthesis due to its unique stereochemical properties. It serves as a valuable building block in the creation of complex organic molecules, offering enhanced control over the spatial arrangement of functional groups. This compound is particularly useful in the pharmaceutical industry for the synthesis of chiral drugs and bioactive compounds. Its specific stereochemistry enables precise manipulation of molecular structures, making it an essential tool for organic chemists striving to design and produce novel compounds with targeted biological activities. Additionally, (2R,5S)-tert-Butyl 2,5-dimethylpiperazine-1-carboxylate finds applications in the development of agrochemicals, materials science, and other fields where stereochemical control is crucial for optimizing the properties and functions of chemical products.