logo
Home  > Inhibitors/Agonists  > Stem Cells/Wnt  > Hedgehog  > Mebendazole

AD51576

31431-39-7 | Mebendazole

Packsize Purity Availability Price Discounted Price    Quantity
5g 97% in stock $21.00 $15.00 -   +
10g 97% in stock $26.00 $18.00 -   +
25g 97% in stock $31.00 $22.00 -   +
100g 97% in stock $77.00 $54.00 -   +

*All products are for research use only and not intended for human or animal use.

*All prices are in USD.

Description
Catalog Number: AD51576
Chemical Name: Mebendazole
CAS Number: 31431-39-7
Molecular Formula: C16H13N3O3
Molecular Weight: 295.2927
MDL Number: MFCD00057872
SMILES: COC(=O)Nc1[nH]c2c(n1)cc(cc2)C(=O)c1ccccc1

 

Upstream Synthesis Route
  • Methyl 5-benzoyl-2-benzimidazolecarbamate is a versatile compound utilized in various chemical synthesis processes. Due to its unique structure and properties, it serves as a key building block in the production of pharmaceuticals, agrochemicals, and materials science.In chemical synthesis, Methyl 5-benzoyl-2-benzimidazolecarbamate acts as a crucial intermediate for the creation of complex organic molecules. Its functional groups and reactivity allow for the formation of intricate bonds and structural motifs that are essential in the development of novel compounds. This compound can be employed in the synthesis of biologically active molecules, such as potential drug candidates or pesticide formulations.Furthermore, Methyl 5-benzoyl-2-benzimidazolecarbamate plays a significant role in the design and fabrication of advanced materials. Its incorporation into polymers, resins, or coatings imparts specific properties and characteristics, enhancing the performance and functionality of the final material. This compound also serves as a valuable tool for chemical researchers and synthetic chemists seeking to explore new synthetic pathways and strategies in the pursuit of innovative products and technologies.
FEATURED PRODUCTS