AB78019
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
1g | 98% | in stock | $16.00 | $12.00 | - + | |
5g | 98% | in stock | $37.00 | $26.00 | - + | |
25g | 98% | in stock | $55.00 | $39.00 | - + | |
500g | 98% | in stock | $746.00 | $522.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AB78019 |
Chemical Name: | Oxalic acid diphenyl ester |
CAS Number: | 3155-16-6 |
Molecular Formula: | C14H10O4 |
Molecular Weight: | 242.2268 |
MDL Number: | MFCD00059682 |
SMILES: | O=C(C(=O)Oc1ccccc1)Oc1ccccc1 |
NSC Number: | 400575 |
Complexity: | 258 |
Covalently-Bonded Unit Count: | 1 |
Heavy Atom Count: | 18 |
Hydrogen Bond Acceptor Count: | 4 |
Rotatable Bond Count: | 5 |
XLogP3: | 3.5 |
ChemSusChem 20120801
Bioorganic & medicinal chemistry 20110801
International journal of nanomedicine 20081201