AV18354
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
1mg | 95% | in stock | $42.00 | $29.00 | - + | |
2mg | 95% | in stock | $62.00 | $43.00 | - + | |
5mg | 95% | in stock | $90.00 | $63.00 | - + | |
10mg | 95% | in stock | $142.00 | $99.00 | - + | |
100mg | 95% | in stock | $275.00 | $193.00 | - + | |
250mg | 95% | in stock | $465.00 | $325.00 | - + | |
1g | 95% | in stock | $1,086.00 | $760.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AV18354 |
Chemical Name: | Cytosporone B |
CAS Number: | 321661-62-5 |
Molecular Formula: | C18H26O5 |
Molecular Weight: | 322.396 |
MDL Number: | MFCD12912406 |
SMILES: | CCCCCCCC(=O)c1c(O)cc(cc1CC(=O)OCC)O |
Complexity: | 368 |
Covalently-Bonded Unit Count: | 1 |
Heavy Atom Count: | 23 |
Hydrogen Bond Acceptor Count: | 5 |
Hydrogen Bond Donor Count: | 2 |
Rotatable Bond Count: | 11 |
XLogP3: | 4.6 |
Marine drugs 20120401
Expert opinion on therapeutic targets 20110201
Cancer research 20100501
Nature chemical biology 20080901
The Journal of biological chemistry 20050513
Cell 20030613
Nature 20030529