AI47645
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
10g | 98% | in stock | $8.00 | $5.00 | - + | |
25g | 98% | in stock | $15.00 | $10.00 | - + | |
100g | 98% | in stock | $48.00 | $33.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AI47645 |
Chemical Name: | Boc-Ser-OH |
CAS Number: | 3262-72-4 |
Molecular Formula: | C8H15NO5 |
Molecular Weight: | 205.2084 |
MDL Number: | MFCD00037243 |
SMILES: | OC[C@@H](C(=O)O)NC(=O)OC(C)(C)C |
Boc-Ser-OH is a crucial reagent in chemical synthesis, particularly in peptide and drug development. This compound, also known as Boc-Serine, serves as a key building block in the creation of peptides due to its unique properties.In the realm of organic chemistry, Boc-Ser-OH is commonly utilized as a protected form of serine, an amino acid essential for the formation of peptide bonds. By incorporating Boc-Ser-OH into synthetic pathways, chemists can selectively control the reactivity of the serine moiety, allowing for precise manipulation of the peptide structure.Furthermore, Boc-Ser-OH plays a vital role in peptide synthesis by serving as a temporary protecting group. The Boc (tert-butyloxycarbonyl) group shields the serine residue from unwanted reactions during peptide assembly, ensuring that the desired sequence is formed accurately. Once the peptide chain is fully constructed, the Boc protecting group can be easily removed under mild conditions, revealing the unaltered serine unit.Overall, the strategic use of Boc-Ser-OH in chemical synthesis enables chemists to construct complex peptides and pharmaceutical compounds with high purity and efficiency. By harnessing the versatile properties of Boc-Ser-OH, researchers can unlock new possibilities in drug discovery and biotechnology.