AB46750
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
10g | 97% | in stock | $6.00 | $4.00 | - + | |
25g | 97% | in stock | $8.00 | $5.00 | - + | |
100g | 97% | in stock | $14.00 | $10.00 | - + | |
500g | 97% | in stock | $67.00 | $47.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AB46750 |
Chemical Name: | Nickel acetylacetonate |
CAS Number: | 3264-82-2 |
Molecular Formula: | C10H14NiO4 |
Molecular Weight: | 256.9092 |
MDL Number: | MFCD00149059 |
SMILES: | CC(=CC(=O)C)O[Ni]OC(=CC(=O)C)C |
Complexity: | 239 |
Covalently-Bonded Unit Count: | 3 |
Defined Bond Stereocenter Count: | 2 |
Heavy Atom Count: | 15 |
Hydrogen Bond Acceptor Count: | 4 |
Hydrogen Bond Donor Count: | 2 |
Rotatable Bond Count: | 2 |
Nickel(II) acetylacetonate is a versatile coordination compound widely used in chemical synthesis due to its unique properties. This compound serves as a valuable catalyst in various organic reactions, particularly in cross-coupling reactions and C–H functionalization. Its ability to facilitate bond formation and activation makes it an essential component in the synthesis of complex organic molecules.Nickel(II) acetylacetonate is commonly employed in the production of pharmaceuticals, agrochemicals, and materials science. Its catalytic activity enables efficient and selective transformations, enhancing the overall yield and purity of the desired products. Additionally, this compound is utilized in the preparation of metal organic frameworks (MOFs) and other coordination polymers due to its coordination chemistry.Furthermore, the ease of handling and storage of nickel(II) acetylacetonate make it a convenient option for researchers and industrial chemists. Its stability and compatibility with a wide range of solvents make it a preferred catalyst in various synthetic protocols. Overall, the application of nickel(II) acetylacetonate in chemical synthesis contributes significantly to the advancement of modern organic chemistry and the production of valuable compounds.