AF87953
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
250mg | 96% | in stock | $291.00 | $204.00 | - + | |
1g | 96% | in stock | $628.00 | $440.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AF87953 |
Chemical Name: | 2-(4-Aminophenyl)-6-fluorobenzothiazole |
CAS Number: | 328087-15-6 |
Molecular Formula: | C13H9FN2S |
Molecular Weight: | 244.2874 |
MDL Number: | MFCD14704351 |
SMILES: | Nc1ccc(cc1)c1nc2c(s1)cc(cc2)F |
NSC Number: | 702153 |
Complexity: | 268 |
Covalently-Bonded Unit Count: | 1 |
Heavy Atom Count: | 17 |
Hydrogen Bond Acceptor Count: | 4 |
Hydrogen Bond Donor Count: | 1 |
Rotatable Bond Count: | 1 |
XLogP3: | 3.7 |
Bioorganic & medicinal chemistry 20110501
Journal of medicinal chemistry 20010426