AB60103
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
1g | 95% | in stock | $8.00 | $6.00 | - + | |
5g | 95% | in stock | $31.00 | $22.00 | - + | |
25g | 95% | in stock | $101.00 | $71.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AB60103 |
Chemical Name: | 2,4-Bis(trifluoromethyl)benzoic acid |
CAS Number: | 32890-87-2 |
Molecular Formula: | C9H4F6O2 |
Molecular Weight: | 258.1173 |
MDL Number: | MFCD00042496 |
SMILES: | OC(=O)c1ccc(cc1C(F)(F)F)C(F)(F)F |
Complexity: | 295 |
Covalently-Bonded Unit Count: | 1 |
Heavy Atom Count: | 17 |
Hydrogen Bond Acceptor Count: | 8 |
Hydrogen Bond Donor Count: | 1 |
Rotatable Bond Count: | 1 |
XLogP3: | 3.2 |
Bioorganic & medicinal chemistry letters 20101101
Xenobiotica; the fate of foreign compounds in biological systems 20020701