AF68119
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
1mg | 98% | in stock | $7.00 | $5.00 | - + | |
5mg | 98% | in stock | $11.00 | $8.00 | - + | |
10mg | 98% | in stock | $15.00 | $11.00 | - + | |
25mg | 98% | in stock | $24.00 | $17.00 | - + | |
50mg | 98% | in stock | $40.00 | $28.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AF68119 |
Chemical Name: | BRD7116 |
CAS Number: | 329059-55-4 |
Molecular Formula: | C28H36N2O4S |
Molecular Weight: | 496.6614 |
MDL Number: | MFCD02168947 |
SMILES: | O=C(C1C(C1(C)C)(C)C)Nc1ccc(cc1)S(=O)(=O)c1ccc(cc1)NC(=O)C1C(C1(C)C)(C)C |
Complexity: | 859 |
Covalently-Bonded Unit Count: | 1 |
Heavy Atom Count: | 35 |
Hydrogen Bond Acceptor Count: | 4 |
Hydrogen Bond Donor Count: | 2 |
Rotatable Bond Count: | 6 |
XLogP3: | 5.3 |
Bioorganic & medicinal chemistry letters 20101101
European journal of biochemistry 19751215