AF68099
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
1mg | 95% | in stock | $42.00 | $29.00 | - + | |
10mg | 95% | in stock | $146.00 | $102.00 | - + | |
25mg | 95% | in stock | $189.00 | $132.00 | - + | |
50mg | 95% | in stock | $246.00 | $172.00 | - + | |
100mg | 95% | in stock | $415.00 | $290.00 | - + | |
250mg | 95% | in stock | $789.00 | $552.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AF68099 |
Chemical Name: | 3-{[5-(4-Methylphenyl)thieno[2,3-d]pyrimidin-4-yl]sulfanyl}propanoic acid |
CAS Number: | 329907-28-0 |
Molecular Formula: | C16H14N2O2S2 |
Molecular Weight: | 330.4246 |
MDL Number: | MFCD02654497 |
SMILES: | OC(=O)CCSc1ncnc2c1c(cs2)c1ccc(cc1)C |
Complexity: | 388 |
Covalently-Bonded Unit Count: | 1 |
Heavy Atom Count: | 22 |
Hydrogen Bond Acceptor Count: | 6 |
Hydrogen Bond Donor Count: | 1 |
Rotatable Bond Count: | 5 |
XLogP3: | 3.9 |
European journal of medicinal chemistry 20110301