AB50220
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
100mg | 95% | in stock | $7.00 | $5.00 | - + | |
250mg | 95% | in stock | $11.00 | $8.00 | - + | |
1g | 95% | in stock | $21.00 | $15.00 | - + | |
5g | 95% | in stock | $104.00 | $73.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AB50220 |
Chemical Name: | 4-(5-(Trifluoromethyl)-1,2,4-oxadiazol-3-yl)benzoic acid |
CAS Number: | 340736-76-7 |
Molecular Formula: | C10H5F3N2O3 |
Molecular Weight: | 258.1535 |
MDL Number: | MFCD16659622 |
SMILES: | OC(=O)c1ccc(cc1)c1noc(n1)C(F)(F)F |
Complexity: | 316 |
Covalently-Bonded Unit Count: | 1 |
Heavy Atom Count: | 18 |
Hydrogen Bond Acceptor Count: | 8 |
Hydrogen Bond Donor Count: | 1 |
Rotatable Bond Count: | 2 |
XLogP3: | 2.2 |
Journal of medicinal chemistry 20081225