AB42737
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
10g | 98% | in stock | $7.00 | $5.00 | - + | |
25g | 98% | in stock | $11.00 | $8.00 | - + | |
100g | 98% | in stock | $35.00 | $25.00 | - + | |
500g | 98% | in stock | $150.00 | $105.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AB42737 |
Chemical Name: | L-Tyrosine methyl ester HCl |
CAS Number: | 3417-91-2 |
Molecular Formula: | C10H14ClNO3 |
Molecular Weight: | 231.6761 |
MDL Number: | MFCD00012607 |
SMILES: | COC(=O)[C@H](Cc1ccc(cc1)O)N.Cl |
Complexity: | 188 |
Covalently-Bonded Unit Count: | 2 |
Defined Atom Stereocenter Count: | 1 |
Heavy Atom Count: | 15 |
Hydrogen Bond Acceptor Count: | 4 |
Hydrogen Bond Donor Count: | 3 |
Rotatable Bond Count: | 4 |
European journal of medicinal chemistry 20120401
Nature chemical biology 20090101