AB50163
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
250mg | 95+% | in stock | $193.00 | $135.00 | - + | |
1g | 95% | in stock | $251.00 | $176.00 | - + | |
5g | 95% | in stock | $760.00 | $532.00 | - + | |
10g | 95% | in stock | $1,334.00 | $934.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AB50163 |
Chemical Name: | 5-(Trifluoromethyl)-1H-indole-2,3-dione |
CAS Number: | 345-32-4 |
Molecular Formula: | C9H4F3NO2 |
Molecular Weight: | 215.1288 |
MDL Number: | MFCD01569510 |
SMILES: | O=C1Nc2c(C1=O)cc(cc2)C(F)(F)F |
Complexity: | 313 |
Covalently-Bonded Unit Count: | 1 |
Heavy Atom Count: | 15 |
Hydrogen Bond Acceptor Count: | 5 |
Hydrogen Bond Donor Count: | 1 |
XLogP3: | 1.7 |
Journal of agricultural and food chemistry 20110928