AB66833
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
1g | 97% | in stock | $23.00 | $17.00 | - + | |
5g | 97% | in stock | $66.00 | $46.00 | - + | |
25g | 97% | in stock | $152.00 | $106.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AB66833 |
Chemical Name: | 4-Bromo-2,6-dichlorobenzenesulfonyl chloride |
CAS Number: | 351003-54-8 |
Molecular Formula: | C6H2BrCl3O2S |
Molecular Weight: | 324.4069 |
MDL Number: | MFCD03094651 |
SMILES: | Clc1cc(Br)cc(c1S(=O)(=O)Cl)Cl |
Complexity: | 264 |
Covalently-Bonded Unit Count: | 1 |
Heavy Atom Count: | 13 |
Hydrogen Bond Acceptor Count: | 2 |
Rotatable Bond Count: | 1 |
XLogP3: | 3.9 |
Journal of medicinal chemistry 20120112