AB42714
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
100mg | 95% | in stock | $11.00 | $8.00 | - + | |
250mg | 95% | in stock | $19.00 | $14.00 | - + | |
1g | 95% | in stock | $61.00 | $43.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AB42714 |
Chemical Name: | 2-Iodoadenosine |
CAS Number: | 35109-88-7 |
Molecular Formula: | C10H12IN5O4 |
Molecular Weight: | 393.1379 |
MDL Number: | MFCD31665680 |
SMILES: | OC[C@H]1O[C@H]([C@@H]([C@@H]1O)O)n1cnc2c1nc(I)nc2N |
Complexity: | 367 |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 4 |
Heavy Atom Count: | 20 |
Hydrogen Bond Acceptor Count: | 8 |
Hydrogen Bond Donor Count: | 4 |
Rotatable Bond Count: | 2 |
XLogP3: | -0.4 |
Journal of medicinal chemistry 20020117