AI48783
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
5g | 98% | in stock | $10.00 | $7.00 | - + | |
10g | 98% | in stock | $13.00 | $9.00 | - + | |
25g | 98% | in stock | $28.00 | $19.00 | - + | |
100g | 98% | in stock | $48.00 | $34.00 | - + | |
500g | 98% | in stock | $173.00 | $121.00 | - + | |
1kg | 98% | in stock | $315.00 | $220.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AI48783 |
Chemical Name: | Fmoc-Phe-OH |
CAS Number: | 35661-40-6 |
Molecular Formula: | C24H21NO4 |
Molecular Weight: | 387.4278 |
MDL Number: | MFCD00037128 |
SMILES: | O=C(N[C@H](C(=O)O)Cc1ccccc1)OCC1c2ccccc2-c2c1cccc2 |
Complexity: | 551 |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 1 |
Heavy Atom Count: | 29 |
Hydrogen Bond Acceptor Count: | 4 |
Hydrogen Bond Donor Count: | 2 |
Rotatable Bond Count: | 7 |
XLogP3: | 4.6 |
Fmoc-Phe-OH is a key reagent commonly used in chemical synthesis for the modification of peptides and proteins. This compound serves as a building block in peptide chemistry, allowing for the selective introduction of phenylalanine residues into peptide sequences. Through its Fmoc (9-fluorenylmethyloxycarbonyl) protection group, Fmoc-Phe-OH enables the controlled and sequential assembly of peptides through solid-phase peptide synthesis (SPPS). This protection group effectively shields the amine group of phenylalanine, preventing unwanted side reactions and facilitating stepwise peptide elongation. With its versatile applications in peptide synthesis, Fmoc-Phe-OH plays a crucial role in the development of peptide-based therapeutics, biomaterials, and chemical probes.