AB67469
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
10g | 98% | in stock | $12.00 | $8.00 | - + | |
25g | 98% | in stock | $26.00 | $18.00 | - + | |
100g | 98% | in stock | $52.00 | $37.00 | - + | |
500g | 98% | in stock | $161.00 | $113.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AB67469 |
Chemical Name: | 4-Fluoro-2-nitroaniline |
CAS Number: | 364-78-3 |
Molecular Formula: | C6H5FN2O2 |
Molecular Weight: | 156.1145032 |
MDL Number: | MFCD00007830 |
SMILES: | Fc1ccc(c(c1)[N+](=O)[O-])N |
NSC Number: | 402980 |
Complexity: | 159 |
Covalently-Bonded Unit Count: | 1 |
Heavy Atom Count: | 11 |
Hydrogen Bond Acceptor Count: | 4 |
Hydrogen Bond Donor Count: | 1 |
XLogP3: | 1.3 |
4-Fluoro-2-nitroaniline, also known as $name$, plays a crucial role in chemical synthesis as a versatile building block in the production of various compounds. Its unique chemical properties make it a valuable intermediate for the synthesis of a wide range of products in the pharmaceutical, agrochemical, and material science industries. In organic chemistry, 4-Fluoro-2-nitroaniline is commonly used as a precursor in the preparation of complex molecules and organic materials due to its ability to undergo various reactions, such as nitration, reduction, and substitution. This compound serves as a key component for the creation of dyes, pigments, and pharmaceuticals, demonstrating its significance in the field of chemical synthesis.