AB43523
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
5g | 95% | in stock | $26.00 | $18.00 | - + | |
25g | 95% | in stock | $33.00 | $23.00 | - + | |
100g | 95% | in stock | $82.00 | $57.00 | - + | |
500g | 95% | in stock | $267.00 | $187.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AB43523 |
Chemical Name: | 2,2,3,4,4,4-Hexafluorobutyl methacrylate |
CAS Number: | 36405-47-7 |
Molecular Formula: | C8H8F6O2 |
Molecular Weight: | 250.1383 |
MDL Number: | MFCD00042311 |
SMILES: | FC(C(COC(=O)C(=C)C)(F)F)C(F)(F)F |
2,2,3,4,4,4-Hexafluorobutyl methacrylate, known for its remarkable chemical properties, plays a crucial role in chemical synthesis processes. As a versatile monomer, it offers a wide range of applications in the field of polymer chemistry and material science. With its unique structure containing fluorine atoms, this compound serves as a valuable building block for the synthesis of specialized polymers and coatings.In chemical synthesis, 2,2,3,4,4,4-Hexafluorobutyl methacrylate can be utilized to introduce fluorinated moieties into various polymer chains. This incorporation of fluorine atoms enhances the properties of the resulting materials, such as increased chemical resistance, thermal stability, and hydrophobicity. These characteristics make it particularly valuable in the development of coatings, adhesives, and specialty polymers for advanced industrial applications.Furthermore, the presence of the methacrylate group in this compound allows for facile polymerization reactions, enabling the formation of well-defined polymer structures with controlled molecular weights and compositions. Through copolymerization with other monomers, tailored materials with specific properties can be achieved, making 2,2,3,4,4,4-Hexafluorobutyl methacrylate a valuable tool for designing advanced polymeric systems.Overall, the application of 2,2,3,4,4,4-Hexafluorobutyl methacrylate in chemical synthesis offers exciting possibilities for creating innovative materials with enhanced performance characteristics, making it a valuable component in the toolkit of polymer chemists and materials scientists.