AF57439
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
250mg | 95% | in stock | $139.00 | $97.00 | - + | |
1g | ≥ 99% (HPLC) | in stock | $209.00 | $147.00 | - + | |
5g | ≥ 99% (HPLC) | in stock | $881.00 | $617.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AF57439 |
Chemical Name: | 4-Methylumbelliferyl 2-acetamido-2-deoxy-beta-d-galactopyranoside |
CAS Number: | 36476-29-6 |
Molecular Formula: | C18H21NO8 |
Molecular Weight: | 379.3612 |
MDL Number: | MFCD03791283 |
SMILES: | OC[C@H]1O[C@@H](Oc2ccc3c(c2)oc(=O)cc3C)[C@@H]([C@H]([C@H]1O)O)NC(=O)C |
Complexity: | 608 |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 5 |
Heavy Atom Count: | 27 |
Hydrogen Bond Acceptor Count: | 8 |
Hydrogen Bond Donor Count: | 4 |
Rotatable Bond Count: | 4 |
XLogP3: | -0.8 |
Nihon Ishinkin Gakkai zasshi = Japanese journal of medical mycology 20050101