AB57556
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
1g | 98% | in stock | $11.00 | $8.00 | - + | |
5g | 98% | in stock | $20.00 | $14.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AB57556 |
Chemical Name: | 1,5-Dichloro-2,4-dinitrobenzene |
CAS Number: | 3698-83-7 |
Molecular Formula: | C6H2Cl2N2O4 |
Molecular Weight: | 236.9971 |
MDL Number: | MFCD00024186 |
SMILES: | Clc1cc(Cl)c(cc1N(=O)=O)N(=O)=O |
1,5-Dichloro-2,4-dinitrobenzene, also known as DCNB, is a versatile chemical compound widely used in chemical synthesis processes. This compound is commonly utilized as a key intermediate in the manufacturing of various organic compounds, particularly in the production of pesticides, dyes, and pharmaceuticals.In chemical synthesis, 1,5-Dichloro-2,4-dinitrobenzene plays a crucial role as a building block in the creation of complex molecules. Its unique structure and reactivity make it an important reagent for introducing functional groups such as nitro and chloro substituents into organic molecules. This compound is particularly valued for its ability to undergo various transformative reactions, enabling chemists to modify its structure to yield a wide range of products with diverse properties.Moreover, 1,5-Dichloro-2,4-dinitrobenzene is often employed in the synthesis of herbicides and insecticides due to its potent biological activity against pests and weeds. By incorporating this compound into chemical formulations, researchers can develop effective and environmentally sustainable solutions for crop protection and pest control.Overall, the application of 1,5-Dichloro-2,4-dinitrobenzene in chemical synthesis underscores its significance as a fundamental building block in the development of innovative compounds with diverse industrial applications.