AB55221
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
1g | 98% | in stock | $15.00 | $11.00 | - + | |
5g | 98% | in stock | $35.00 | $25.00 | - + | |
10g | 98% | in stock | $67.00 | $47.00 | - + | |
25g | 98% | in stock | $133.00 | $94.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AB55221 |
Chemical Name: | (4S,5S)-2,2-Dimethyl-1,3-dioxolane-4,5-dicarboxylic acid dimethyl ester |
CAS Number: | 37031-30-4 |
Molecular Formula: | C11H18O6 |
Molecular Weight: | 246.257 |
MDL Number: | MFCD00040504 |
SMILES: | CCOC(=O)[C@H]1OC(O[C@@H]1C(=O)OCC)(C)C |
Complexity: | 246 |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 2 |
Heavy Atom Count: | 15 |
Hydrogen Bond Acceptor Count: | 6 |
Rotatable Bond Count: | 4 |
XLogP3: | 0.3 |
Nature chemistry 20110801
The Journal of organic chemistry 20010615