AF70031
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
100mg | 98% | in stock | $12.00 | $9.00 | - + | |
250mg | 98% | in stock | $15.00 | $11.00 | - + | |
500mg | 98% | in stock | $30.00 | $21.00 | - + | |
1g | 98% | in stock | $57.00 | $40.00 | - + | |
5g | 98% | in stock | $266.00 | $186.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AF70031 |
Chemical Name: | Fmoc-l-cycpentala-oh |
CAS Number: | 371770-32-0 |
Molecular Formula: | C23H25NO4 |
Molecular Weight: | 379.4489 |
MDL Number: | MFCD03094886 |
SMILES: | O=C(N[C@H](C(=O)O)CC1CCCC1)OCC1c2ccccc2-c2c1cccc2 |
Complexity: | 537 |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 1 |
Heavy Atom Count: | 28 |
Hydrogen Bond Acceptor Count: | 4 |
Hydrogen Bond Donor Count: | 2 |
Rotatable Bond Count: | 7 |
XLogP3: | 5.2 |
The amino acid derivative, (αS)-α-[[(9H-Fluoren-9-ylmethoxy)carbonyl]amino]cyclopentanepropanoic acid, plays a crucial role in chemical synthesis as a versatile building block. Its unique structure enables it to be utilized as a key intermediate in the development of pharmaceutical compounds and functional materials. This compound serves as a valuable tool in peptide chemistry, as it can be functionalized and modified to introduce specific chemical functionalities at precise positions along the peptide backbone. By incorporating (αS)-α-[[(9H-Fluoren-9-ylmethoxy)carbonyl]amino]cyclopentanepropanoic acid into synthetic pathways, chemists can access complex molecules with enhanced biological activity or tailored physical properties.