AF57720
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
1mg | 98% | in stock | $46.00 | $32.00 | - + | |
2mg | 98% | in stock | $65.00 | $45.00 | - + | |
5mg | 98% | in stock | $93.00 | $65.00 | - + | |
25mg | 98% | in stock | $262.00 | $183.00 | - + | |
50mg | 98% | in stock | $443.00 | $310.00 | - + | |
100mg | 98% | in stock | $752.00 | $526.00 | - + | |
250mg | 98% | in stock | $1,503.00 | $1,052.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AF57720 |
Chemical Name: | YM-201636 |
CAS Number: | 371942-69-7 |
Molecular Formula: | C25H21N7O3 |
Molecular Weight: | 467.47933999999987 |
MDL Number: | MFCD16038303 |
SMILES: | Nc1ccc(cn1)C(=O)Nc1cccc(c1)c1nc(N2CCOCC2)c2c(n1)c1cccnc1o2 |
Complexity: | 738 |
Covalently-Bonded Unit Count: | 1 |
Heavy Atom Count: | 35 |
Hydrogen Bond Acceptor Count: | 9 |
Hydrogen Bond Donor Count: | 2 |
Rotatable Bond Count: | 4 |
XLogP3: | 2.5 |
Journal of medicinal chemistry 20121108
PloS one 20120101
PloS one 20120101
PLoS genetics 20111001
Traffic (Copenhagen, Denmark) 20110401
The EMBO journal 20100421
Biochemical and biophysical research communications 20090508
EMBO reports 20080201