AI49234
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
250mg | 95% | in stock | $30.00 | $21.00 | - + | |
1g | 95% | in stock | $60.00 | $42.00 | - + | |
5g | 95% | in stock | $182.00 | $127.00 | - + | |
25g | 95% | in stock | $572.00 | $400.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AI49234 |
Chemical Name: | Ethyl 2-(2-nitrophenoxy)acetate |
CAS Number: | 37682-31-8 |
Molecular Formula: | C10H11NO5 |
Molecular Weight: | 225.198 |
MDL Number: | MFCD00100679 |
SMILES: | CCOC(=O)COc1ccccc1[N+](=O)[O-] |
Complexity: | 250 |
Covalently-Bonded Unit Count: | 1 |
Heavy Atom Count: | 16 |
Hydrogen Bond Acceptor Count: | 5 |
Rotatable Bond Count: | 5 |
XLogP3: | 1.7 |
Applied microbiology and biotechnology 20120401