AW45291
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
50mg | 95% | 1 week | $419.00 | $293.00 | - + | |
100mg | 95% | 1 week | $601.00 | $421.00 | - + | |
250mg | 95% | 1 week | $838.00 | $587.00 | - + | |
500mg | 95% | 1 week | $1,290.00 | $903.00 | - + | |
1g | 95% | 1 week | $1,640.00 | $1,148.00 | - + | |
2.5g | 95% | 1 week | $3,165.00 | $2,215.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AW45291 |
Chemical Name: | ethyl 4-tert-butyl-2-oxocyclopentane-1-carboxylate, Mixture of diastereomers |
CAS Number: | 37829-06-4 |
Molecular Formula: | C12H20O3 |
Molecular Weight: | 212.2854 |
MDL Number: | MFCD29763191 |
SMILES: | CCOC(=O)C1CC(CC1=O)C(C)(C)C |