AF57266
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
1g | 95% | in stock | $105.00 | $74.00 | - + | |
5g | 95% | in stock | $386.00 | $270.00 | - + | |
25g | 95% | in stock | $1,504.00 | $1,053.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AF57266 |
Chemical Name: | 3-(3,5-Dichlorophenyl)benzoic acid |
CAS Number: | 380228-57-9 |
Molecular Formula: | C13H8Cl2O2 |
Molecular Weight: | 267.1074 |
MDL Number: | MFCD03426495 |
SMILES: | Clc1cc(Cl)cc(c1)c1cccc(c1)C(=O)O |
Complexity: | 273 |
Covalently-Bonded Unit Count: | 1 |
Heavy Atom Count: | 17 |
Hydrogen Bond Acceptor Count: | 2 |
Hydrogen Bond Donor Count: | 1 |
Rotatable Bond Count: | 2 |
XLogP3: | 4.9 |
Journal of medicinal chemistry 20050407
Journal of medicinal chemistry 20040115