AB46127
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
1g | 97% | in stock | $12.00 | $8.00 | - + | |
5g | 97% | in stock | $13.00 | $10.00 | - + | |
10g | 97% | in stock | $24.00 | $17.00 | - + | |
25g | 97% | in stock | $38.00 | $27.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AB46127 |
Chemical Name: | Ethyl o-mesitylsulfonylacetohydroxamate |
CAS Number: | 38202-27-6 |
Molecular Formula: | C13H19NO4S |
Molecular Weight: | 285.3593 |
MDL Number: | MFCD00009244 |
SMILES: | CCOC(=NOS(=O)(=O)c1c(C)cc(cc1C)C)C |
Complexity: | 401 |
Covalently-Bonded Unit Count: | 1 |
Defined Bond Stereocenter Count: | 1 |
Heavy Atom Count: | 19 |
Hydrogen Bond Acceptor Count: | 5 |
Rotatable Bond Count: | 5 |
XLogP3: | 3.3 |
Ethyl O-mesitylsulfonylacetohydroxamate is a versatile compound commonly used in chemical synthesis as a powerful reagent for the amidation of carboxylic acids. Its unique structure enables it to efficiently convert carboxylic acids into amides through an amidation reaction, which is a key transformation in organic synthesis. This compound is particularly valuable in the preparation of various pharmaceuticals, agrochemicals, and functional materials where amide formation is essential. Additionally, Ethyl O-mesitylsulfonylacetohydroxamate is known for its high efficacy, selectivity, and mild reaction conditions, making it a preferred choice for chemists working on complex molecule synthesis. Its application in chemical synthesis contributes to the development of novel compounds with diverse biological and material properties.