AB61362
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
5g | 97% | in stock | $9.00 | $7.00 | - + | |
10g | 97% | in stock | $15.00 | $11.00 | - + | |
25g | 97% | in stock | $36.00 | $25.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AB61362 |
Chemical Name: | 4-(Trifluoromethyl)phenacyl bromide |
CAS Number: | 383-53-9 |
Molecular Formula: | C9H6BrF3O |
Molecular Weight: | 267.0425 |
MDL Number: | MFCD00126489 |
SMILES: | BrCC(=O)c1ccc(cc1)C(F)(F)F |
NSC Number: | 277303 |
Complexity: | 207 |
Covalently-Bonded Unit Count: | 1 |
Heavy Atom Count: | 14 |
Hydrogen Bond Acceptor Count: | 4 |
Rotatable Bond Count: | 2 |
XLogP3: | 3.3 |
Journal of medicinal chemistry 20110623
Bioorganic & medicinal chemistry letters 20021104