AF69740
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
250mg | 98% | in stock | $106.00 | $75.00 | - + | |
1g | 98% | in stock | $235.00 | $165.00 | - + | |
5g | 98% | in stock | $1,063.00 | $744.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AF69740 |
Chemical Name: | L-Isoleucyl-L-tyrosine |
CAS Number: | 38579-21-4 |
Molecular Formula: | C15H22N2O4 |
Molecular Weight: | 294.3462 |
MDL Number: | MFCD00063032 |
SMILES: | CC[C@@H]([C@@H](C(=O)N[C@H](C(=O)O)Cc1ccc(cc1)O)N)C |
Complexity: | 354 |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 3 |
Heavy Atom Count: | 21 |
Hydrogen Bond Acceptor Count: | 5 |
Hydrogen Bond Donor Count: | 4 |
Rotatable Bond Count: | 7 |
XLogP3: | -2.2 |
Bioorganic & medicinal chemistry 20110801
Bioscience, biotechnology, and biochemistry 20060901
Journal of medicinal chemistry 20050630
Biological & pharmaceutical bulletin 20040201