AB54660
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
250mg | 95% | in stock | $39.00 | $27.00 | - + | |
1g | 95% | in stock | $70.00 | $49.00 | - + | |
5g | 95% | in stock | $244.00 | $171.00 | - + | |
25g | 95% | in stock | $925.00 | $647.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AB54660 |
Chemical Name: | (1R)-(+)-Nopinone |
CAS Number: | 38651-65-9 |
Molecular Formula: | C9H14O |
Molecular Weight: | 138.2069 |
MDL Number: | MFCD08447116 |
SMILES: | O=C1CC[C@H]2C[C@@H]1C2(C)C |
The (1R,5S)-6,6-Dimethylbicyclo[3.1.1]heptan-2-one is a versatile compound widely used in chemical synthesis, particularly in the production of pharmaceuticals and fine chemicals. Its unique bicyclic structure and stereochemistry make it a valuable building block in organic synthesis.The compound is commonly utilized as a chiral starting material in the asymmetric synthesis of complex molecules. Its rigid structure and specific stereochemistry impart chirality, allowing chemists to control the three-dimensional orientation of atoms in the molecules they are constructing. This precise control is crucial in the development of pharmaceuticals, where the biological activity of a molecule is often dependent on its chirality.In addition to its role as a chiral building block, (1R,5S)-6,6-Dimethylbicyclo[3.1.1]heptan-2-one can also serve as a key intermediate in the synthesis of natural products and bioactive compounds. Its unique structure lends itself to diverse functionalization reactions, enabling the introduction of various chemical groups to tailor the properties of the final product.Overall, the compound plays a vital role in the realm of chemical synthesis, enabling chemists to access structurally complex molecules with defined stereochemistry, paving the way for the development of new drugs, agrochemicals, and materials.