AB80219
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
1g | 98% | in stock | $19.00 | $13.00 | - + | |
5g | 98% | in stock | $46.00 | $32.00 | - + | |
25g | 98% | in stock | $122.00 | $85.00 | - + | |
100g | 96% | in stock | $449.00 | $315.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AB80219 |
Chemical Name: | Tris(4-nitrophenyl) phosphate |
CAS Number: | 3871-20-3 |
Molecular Formula: | C18H12N3O10P |
Molecular Weight: | 461.2757 |
MDL Number: | MFCD00024649 |
SMILES: | O=P(Oc1ccc(cc1)[N+](=O)[O-])(Oc1ccc(cc1)[N+](=O)[O-])Oc1ccc(cc1)[N+](=O)[O-] |
NSC Number: | 66455 |
Complexity: | 617 |
Covalently-Bonded Unit Count: | 1 |
Heavy Atom Count: | 32 |
Hydrogen Bond Acceptor Count: | 10 |
Rotatable Bond Count: | 6 |
XLogP3: | 4.1 |
Inorganic chemistry 20050502
Inorganic chemistry 20050207
Canadian journal of microbiology 20030201
Inorganic chemistry 20010507