AF58945
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
250mg | 97% | in stock | $10.00 | $7.00 | - + | |
1g | 97% | in stock | $15.00 | $11.00 | - + | |
5g | 97% | in stock | $39.00 | $27.00 | - + | |
10g | 97% | in stock | $71.00 | $50.00 | - + | |
25g | 97% | in stock | $148.00 | $104.00 | - + | |
100g | 97% | in stock | $489.00 | $342.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AF58945 |
Chemical Name: | Cis-tert-butyl 3-hydroxycyclobutylcarbamate |
CAS Number: | 389890-43-1 |
Molecular Formula: | C9H17NO3 |
Molecular Weight: | 187.2362 |
MDL Number: | MFCD09038208 |
SMILES: | O[C@@H]1C[C@@H](C1)NC(=O)OC(C)(C)C |
Complexity: | 192 |
Covalently-Bonded Unit Count: | 1 |
Heavy Atom Count: | 13 |
Hydrogen Bond Acceptor Count: | 3 |
Hydrogen Bond Donor Count: | 2 |
Rotatable Bond Count: | 3 |
XLogP3: | 0.9 |
The tert-Butyl (cis-3-hydroxycyclobutyl)carbamate is a versatile compound widely used in chemical synthesis as a protecting group for amines. It is particularly valuable in organic chemistry reactions where selective protection of amine functional groups is required to prevent unwanted reactions or to control regioselectivity. This compound effectively masks the amino group, allowing specific reactions to occur at other sites within a molecule. The tert-Butyl (cis-3-hydroxycyclobutyl)carbamate can be easily introduced and subsequently removed under mild conditions, making it a valuable tool for synthetic chemists seeking to achieve complex molecular designs with precision and efficiency.