AB42689
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
1g | 98% | in stock | $25.00 | $17.00 | - + | |
5g | 98% | in stock | $49.00 | $34.00 | - + | |
10g | 98% | in stock | $82.00 | $58.00 | - + | |
25g | 98% | in stock | $156.00 | $109.00 | - + | |
100g | 98% | in stock | $510.00 | $357.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AB42689 |
Chemical Name: | 2,4,6-Triisopropylbenzenesulfonyl hydrazide |
CAS Number: | 39085-59-1 |
Molecular Formula: | C15H26N2O2S |
Molecular Weight: | 298.4441 |
MDL Number: | MFCD00014750 |
SMILES: | NNS(=O)(=O)c1c(cc(cc1C(C)C)C(C)C)C(C)C |
NSC Number: | 620119 |
Complexity: | 381 |
Covalently-Bonded Unit Count: | 1 |
Heavy Atom Count: | 20 |
Hydrogen Bond Acceptor Count: | 4 |
Hydrogen Bond Donor Count: | 2 |
Rotatable Bond Count: | 5 |
XLogP3: | 3.5 |
The Journal of organic chemistry 20011019