AB67470
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
5g | 97% | in stock | $11.00 | $8.00 | - + | |
10g | 97% | in stock | $14.00 | $10.00 | - + | |
25g | 97% | in stock | $17.00 | $12.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AB67470 |
Chemical Name: | 4-Fluoro-2-nitrobenzoic acid |
CAS Number: | 394-01-4 |
Molecular Formula: | C7H4FNO4 |
Molecular Weight: | 185.1094 |
MDL Number: | MFCD00024300 |
SMILES: | Fc1ccc(c(c1)[N+](=O)[O-])C(=O)O |
Complexity: | 227 |
Covalently-Bonded Unit Count: | 1 |
Heavy Atom Count: | 13 |
Hydrogen Bond Acceptor Count: | 5 |
Hydrogen Bond Donor Count: | 1 |
Rotatable Bond Count: | 1 |
XLogP3: | 1.6 |
4-Fluoro-2-nitrobenzoic acid is a valuable chemical compound widely used in various chemical synthesis processes. This compound plays a crucial role as a versatile building block in the creation of complex organic molecules. In organic synthesis, 4-Fluoro-2-nitrobenzoic acid serves as a key starting material for the preparation of important pharmaceuticals, agrochemicals, and functional materials.One significant application of 4-Fluoro-2-nitrobenzoic acid is its utilization in the synthesis of biologically active compounds, such as pharmaceutical intermediates and new drug candidates. By incorporating this compound into the molecular structure, chemists can introduce specific functional groups and tailor the properties of the final product to achieve desired biological activities.Furthermore, 4-Fluoro-2-nitrobenzoic acid can also be employed in the development of advanced materials with specialized functions. Through strategic chemical transformations and reactions, researchers can use this compound to construct novel polymers, dyes, and other functional materials with tailored properties for diverse applications in industry and research.Overall, the versatility and reactivity of 4-Fluoro-2-nitrobenzoic acid make it an indispensable tool in the toolkit of synthetic chemists, enabling the efficient and precise construction of complex molecular architectures for a wide range of applications.