AF87412
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
100mg | 97% | in stock | $23.00 | $16.00 | - + | |
250mg | 97% | in stock | $42.00 | $30.00 | - + | |
1g | 97% | in stock | $146.00 | $102.00 | - + | |
5g | 97% | in stock | $600.00 | $420.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AF87412 |
Chemical Name: | tert-Butyl 3-amino-6,7-dihydro-1h-pyrazolo[4,3-c]pyridine-5(4h)-carboxylate |
CAS Number: | 398491-64-0 |
Molecular Formula: | C11H18N4O2 |
Molecular Weight: | 238.2862 |
MDL Number: | MFCD12964106 |
SMILES: | O=C(N1CCc2c(C1)c(N)n[nH]2)OC(C)(C)C |
In chemical synthesis, tert-Butyl 3-amino-6,7-dihydro-1H-pyrazolo[4,3-c]pyridine-5(4H)-carboxylate serves as a versatile building block with unique reactivity. Its incorporation into organic reactions can lead to the formation of complex molecular structures with potential applications in pharmaceuticals, agrochemicals, and materials science. By leveraging its specific molecular features, such as the tert-butyl and amino groups, this compound can participate in various transformations including acylation, alkylation, and cyclization reactions. Furthermore, the presence of the pyrazolo-pyridine core offers opportunities for diverse functional group manipulations, enabling the synthesis of novel molecular scaffolds for drug discovery and chemical research.