AB46629
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
5g | 98% | in stock | $6.00 | $4.00 | - + | |
25g | 98% | in stock | $16.00 | $11.00 | - + | |
100g | 98% | in stock | $59.00 | $41.00 | - + | |
500g | 98% | in stock | $286.00 | $201.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AB46629 |
Chemical Name: | N-(9H-Purin-6-yl)benzamide |
CAS Number: | 4005-49-6 |
Molecular Formula: | C12H9N5O |
Molecular Weight: | 239.2328 |
MDL Number: | MFCD00037927 |
SMILES: | O=C(c1ccccc1)NC1=NC=NC2=NC=NC12 |
NSC Number: | 98641 |
Complexity: | 305 |
Covalently-Bonded Unit Count: | 1 |
Heavy Atom Count: | 18 |
Hydrogen Bond Acceptor Count: | 4 |
Hydrogen Bond Donor Count: | 2 |
Rotatable Bond Count: | 2 |
XLogP3: | 1.3 |
Medicinal chemistry (Shariqah (United Arab Emirates)) 20120501
Bioorganic chemistry 20100401
European journal of medicinal chemistry 20091101
Journal of medicinal chemistry 20090723
European journal of medicinal chemistry 20080201
BMC biochemistry 20070101
Nucleosides, nucleotides & nucleic acids 20070101
Organic letters 20060330
Journal of enzyme inhibition and medicinal chemistry 20050801
The Journal of organic chemistry 20030725
The Journal of organic chemistry 20020823
Journal of the American Chemical Society 20020508
Metal-based drugs 20020101
Bioorganic & medicinal chemistry letters 20010409