AI49820
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
1g | 95% | in stock | $13.00 | $9.00 | - + | |
5g | 95% | in stock | $19.00 | $13.00 | - + | |
25g | 95% | in stock | $56.00 | $40.00 | - + | |
500g | 95% | in stock | $1,007.00 | $705.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AI49820 |
Chemical Name: | (2R,3R,4S,5R)-2-(2-amino-8-bromo-6-hydroxy-9H-purin-9-yl)-5-(hydroxymethyl)oxolane-3,4-diol |
CAS Number: | 4016-63-1 |
Molecular Formula: | C10H12BrN5O5 |
Molecular Weight: | 362.13677999999993 |
MDL Number: | MFCD00150531 |
SMILES: | OC[C@H]1O[C@H]([C@@H]([C@@H]1O)O)n1c(Br)nc2c1[nH]c(N)nc2=O |
Complexity: | 479 |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 4 |
Heavy Atom Count: | 21 |
Hydrogen Bond Acceptor Count: | 7 |
Hydrogen Bond Donor Count: | 5 |
Rotatable Bond Count: | 2 |
XLogP3: | -0.9 |
Journal of medicinal chemistry 20091022
The journal of physical chemistry. B 20071108