AD31598
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
100g | 98% | in stock | $24.00 | $17.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AD31598 |
Chemical Name: | 1,3-Bis(trifluoromethyl)benzene |
CAS Number: | 402-31-3 |
Molecular Formula: | C8H4F6 |
Molecular Weight: | 214.1078 |
MDL Number: | MFCD00000392 |
SMILES: | FC(c1cccc(c1)C(F)(F)F)(F)F |
NSC Number: | 10342 |
Complexity: | 171 |
Covalently-Bonded Unit Count: | 1 |
Heavy Atom Count: | 14 |
Hydrogen Bond Acceptor Count: | 6 |
XLogP3: | 3.8 |
Pest management science 20120501
Inorganic chemistry 20120102
Vascular health and risk management 20120101
Chemistry (Weinheim an der Bergstrasse, Germany) 20111223
Journal of the American Chemical Society 20110907
Purinergic signalling 20110601
Journal of lipid research 20101201
Inorganic chemistry 20101018
Journal of the American Chemical Society 20091125
Acta crystallographica. Section C, Crystal structure communications 20090601
The Journal of organic chemistry 20081121
The journal of physical chemistry. A 20080918
Organic letters 20080605
Inorganic chemistry 20071001
International journal of nanomedicine 20070901
The Journal of organic chemistry 20070817
Inorganic chemistry 20070402
Journal of the American Chemical Society 20060503
Journal of the American Chemical Society 20060111
The Journal of organic chemistry 20050805
Journal of the American Chemical Society 20050112
Inorganic chemistry 20041018
Organic & biomolecular chemistry 20040307
The Journal of organic chemistry 20030502
Bioorganic & medicinal chemistry letters 20021104
Bioorganic & medicinal chemistry letters 20020916