AB79875
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
10g | 98% | in stock | $8.00 | $5.00 | - + | |
25g | 98% | in stock | $9.00 | $6.00 | - + | |
100g | 98% | in stock | $20.00 | $14.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AB79875 |
Chemical Name: | H-Hyp-OMe HCl |
CAS Number: | 40216-83-9 |
Molecular Formula: | C6H12ClNO3 |
Molecular Weight: | 181.6174 |
MDL Number: | MFCD00080855 |
SMILES: | COC(=O)[C@@H]1C[C@H](CN1)O.Cl |
Complexity: | 137 |
Covalently-Bonded Unit Count: | 2 |
Defined Atom Stereocenter Count: | 2 |
Heavy Atom Count: | 11 |
Hydrogen Bond Acceptor Count: | 4 |
Hydrogen Bond Donor Count: | 3 |
Rotatable Bond Count: | 2 |
Methyl trans-4-hydroxy-L-prolinate hydrochloride is a versatile compound widely utilized in chemical synthesis, particularly in the field of pharmaceuticals and fine chemicals. It serves as a valuable intermediate in the synthesis of various biologically active molecules and complex organic compounds. Due to its unique chemical structure, this compound plays a crucial role in the preparation of peptide-based drugs, such as antibiotics, antivirals, and anticancer agents. Additionally, Methyl trans-4-hydroxy-L-prolinate hydrochloride is commonly employed in the development of novel catalysts and ligands for organic reactions, showcasing its significance in advancing synthetic methodologies. Its strategic application in chemical synthesis underscores its importance as a key building block in the creation of diverse compounds with significant pharmacological and industrial relevance.
Nature chemical biology 20090101
Bioorganic & medicinal chemistry letters 20040621