AF68200
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
1mg | ≥98% | in stock | $52.00 | $36.00 | - + | |
5mg | ≥98% | in stock | $168.00 | $117.00 | - + | |
10mg | ≥98% | in stock | $276.00 | $193.00 | - + | |
100mg | 95% | in stock | $452.00 | $316.00 | - + | |
250mg | 95% | in stock | $865.00 | $605.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AF68200 |
Chemical Name: | BAY 59-3074 |
CAS Number: | 406205-74-1 |
Molecular Formula: | C18H13F6NO4S |
Molecular Weight: | 453.3555 |
MDL Number: | MFCD09027365 |
SMILES: | N#Cc1c(cccc1C(F)(F)F)Oc1cccc(c1)OS(=O)(=O)CCCC(F)(F)F |
Complexity: | 709 |
Covalently-Bonded Unit Count: | 1 |
Heavy Atom Count: | 30 |
Hydrogen Bond Acceptor Count: | 11 |
Rotatable Bond Count: | 7 |
XLogP3: | 5.4 |
Bioorganic & medicinal chemistry letters 20111001
European journal of medicinal chemistry 20110201
European journal of pharmacology 20041128
The Journal of allergy and clinical immunology 19751201