AB44366
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
100mg | 98% | in stock | $15.00 | $10.00 | - + | |
1g | 98% | in stock | $15.00 | $11.00 | - + | |
5g | 98% | in stock | $27.00 | $19.00 | - + | |
10g | 98% | in stock | $54.00 | $38.00 | - + | |
25g | 98% | in stock | $118.00 | $83.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AB44366 |
Chemical Name: | 3,5-Dinitrobenzonitrile |
CAS Number: | 4110-35-4 |
Molecular Formula: | C7H3N3O4 |
Molecular Weight: | 193.1164 |
MDL Number: | MFCD00007228 |
SMILES: | N#Cc1cc(cc(c1)[N+](=O)[O-])[N+](=O)[O-] |
NSC Number: | 35873 |
Complexity: | 274 |
Covalently-Bonded Unit Count: | 1 |
Heavy Atom Count: | 14 |
Hydrogen Bond Acceptor Count: | 5 |
XLogP3: | 2.4 |
Journal of nanoscience and nanotechnology 20120201
Journal of molecular modeling 20080601
Bioorganic & medicinal chemistry letters 20010723